Gas Detection Tubes
eMolecules 2803456-58-6 | METHYL 4-BENZYL-6,6-DIMETHYLMORPHOLINE-3-CARBOXYLATE | AstaTech263.337 | C15H21NO3 | 95.000 | COC(=O)C1COC(C)(C)CN1Cc1ccccc1 | 0.1g | 705608012
METHYL 4-BENZYL-6,6-DIMETHYLMORPHOLINE-3-CARBOXYLATE | AstaTech | 2803456-58-6263.337 | C15H21NO3 | 95.000 | COC(=O)C1COC(C)(C)CN1Cc1ccccc1 | 0.1g | 705608012
eMolecules 22348-97-6 | Ambeed | Methyl 3-oxotetradecanoate | 250mg | 601097808 | A765511 | MFCD00673474 | 256.386 | C15H28O3
Ambeed | 3-Methoxy-4-(4455-tetramethyl-132-dioxaborolan-2-yl)phenol | 100mg | 525024147 | A123909 | 507462-88-6 | MFCD16994337 | 250.100 | C13H19BO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 35598-05-1 | Ambeed | Methyl 4-methoxy-2-methylbenzoate | 1g | 552712499 | A344306 | MFCD06203918 | 180.203 | C10H12O3
Ambeed | 3-(Methoxycarbonyl)-2-nitrobenzoic acid | 1g | 490553322 | A315352 | 861593-27-3 | MFCD08690069 | 225.156 | C9H7NO6
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 25016-17-5 | Methyl 5-methyl-1H-pyrazole-3-carboxylate | Ambeed | MFCD03778987 | 140.142 | C6H8N2O2 | 97.000 | COC(=O)c1cc(C)[nH]n1 | 1g | 525123616](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502431580.PNG-250.jpg)
eMolecules 25016-17-5 | Methyl 5-methyl-1H-pyrazole-3-carboxylate | Ambeed | MFCD03778987 | 140.142 | C6H8N2O2 | 97.000 | COC(=O)c1cc(C)[nH]n1 | 1g | 525123616
Methyl 5-methyl-1H-pyrazole-3-carboxylate | Ambeed | 25016-17-5 | MFCD03778987 | 140.142 | C6H8N2O2 | 97.000 | COC(=O)c1cc(C)[nH]n1 | 1g | 525123616
eMolecules 13305-09-4 | ChemScene | Methyl 2-hydroxy-2-(4-nitrophenyl)acetate | 100mg | 536795507 | CS-0062208 | 211.173 | C9H9NO5
ChemScene | tert-Butyl (4-amino-3-nitrophenethyl)carbamate | 100mg | 572197879 | CS-0137207 | 159417-94-4 | 281.312 | C13H19N3O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 5338-44-3 | Ethyl 4-acetamidobenzoate | Ambeed | MFCD00157645 | 207.229 | C11H13NO3 | 98.000 | CCOC(=O)c1ccc(NC(C)=O)cc1 | 250mg | 600839678
Ethyl 4-acetamidobenzoate | Ambeed | 5338-44-3 | MFCD00157645 | 207.229 | C11H13NO3 | 98.000 | CCOC(=O)c1ccc(NC(C)=O)cc1 | 250mg | 600839678
eMolecules 5326-50-1 | Ambeed | Ethyl 2-(1-hydroxycyclohexyl)acetate | 250mg | 552608655 | A166743 | MFCD00095227 | 186.251 | C10H18O3
Ambeed | Ethyl 2-(1-hydroxycyclohexyl)acetate | 250mg | 552608655 | A166743 | 5326-50-1 | MFCD00095227 | 186.251 | C10H18O3
eMolecules 26501-83-7 | ChemScene | Ethyl 5-methylfuran-3-carboxylate | 100mg | 596090930 | CS-0158923 | MFCD15143959 | 154.165 | C8H10O3
5-Bromophthalide | Ambeed | 64169-34-2 | MFCD01797360 | 213.030 | C8H5BrO2 | 98.000 | Brc1ccc2C(=O)OCc2c1 | 100g | 525131202
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 19282-45-2 | Ambeed | Ethyl 4567-tetrahydrobenzo[b]thiophene-2-carboxylate | 1g | 525010733 | A115799 | MFCD06662278 | 210.29 | C11H14O2S](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502442400.PNG-250.jpg)
eMolecules 19282-45-2 | Ambeed | Ethyl 4567-tetrahydrobenzo[b]thiophene-2-carboxylate | 1g | 525010733 | A115799 | MFCD06662278 | 210.29 | C11H14O2S
Ambeed | 67-Dimethoxy-23-dimethylquinoxaline | 250mg | 525187031 | A326517 | 32388-00-4 | MFCD04038946 | 218.256 | C12H14N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 774487-83-1 | 4-Methylamino-bicyclo[2.2.2]octane-1-carboxylic acid methyl ester | J&W PharmLab LLC | MFCD23701422 | 197.278 | C11H19NO2 | 96.000 | CNC12CCC(CC1)(CC2)C(=O)OC | 500mg | 689216724](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502480025.JPG-250.jpg)
eMolecules 774487-83-1 | 4-Methylamino-bicyclo[2.2.2]octane-1-carboxylic acid methyl ester | J&W PharmLab LLC | MFCD23701422 | 197.278 | C11H19NO2 | 96.000 | CNC12CCC(CC1)(CC2)C(=O)OC | 500mg | 689216724
4-Methylamino-bicyclo[2.2.2]octane-1-carboxylic acid methyl ester | J&W PharmLab LLC | 774487-83-1 | MFCD23701422 | 197.278 | C11H19NO2 | 96.000 | CNC12CCC(CC1)(CC2)C(=O)OC | 500mg | 689216724
![eMolecules 114676-59-4 | H-D-cis-Hyp-OMe??HCl | Ambeed181.620 | C6H12ClNO3 | 97.000 | Cl.COC(=O)[C@H]1C[C@@H](O)CN1 | 1g | 552658598](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502422737.PNG-250.jpg)
eMolecules 114676-59-4 | H-D-cis-Hyp-OMe??HCl | Ambeed181.620 | C6H12ClNO3 | 97.000 | Cl.COC(=O)[C@H]1C[C@@H](O)CN1 | 1g | 552658598
H-D-cis-Hyp-OMe??HCl | Ambeed | 114676-59-4181.620 | C6H12ClNO3 | 97.000 | Cl.COC(=O)[C@H]1C[C@@H](O)CN1 | 1g | 552658598